C18H19N3O2 — CID 158415586
7-methoxy-4-(oxan-2-yl)-4,5,12-triazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2,5,8,11,13-hexaene (PubChem CID 158415586) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 7-methoxy-4-(oxan-2-yl)-4,5,12-triazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2,5,8,11,13-hexaene.
| Compound Name | 7-methoxy-4-(oxan-2-yl)-4,5,12-triazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2,5,8,11,13-hexaene |
|---|---|
| PubChem CID | 158415586 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 7-methoxy-4-(oxan-2-yl)-4,5,12-triazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2,5,8,11,13-hexaene |
| SMILES | COC1C2=CCc3nccc(c32)-c2cn(C3CCCCO3)nc21 |
| InChI | InChI=1S/C18H19N3O2/c1-22-18-12-5-6-14-16(12)11(7-8-19-14)13-10-21(20-17(13)18)15-4-2-3-9-23-15/h5,7-8,10,15,18H,2-4,6,9H2,1H3 |
| InChIKey | LQLBGGRBDXACEB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |