C38H45N3O2 — CID 158415746
1-[4-[2-[2-[3-(4-propan-2-ylpiperazin-1-yl)phenyl]phenyl]ethoxymethyl]phenyl]-5-pyridin-3-ylpentan-3-one (PubChem CID 158415746) has the molecular formula C38H45N3O2 and a molecular weight of 575.80 g/mol. Its IUPAC name is 1-[4-[2-[2-[3-(4-propan-2-ylpiperazin-1-yl)phenyl]phenyl]ethoxymethyl]phenyl]-5-pyridin-3-ylpentan-3-one.
| Compound Name | 1-[4-[2-[2-[3-(4-propan-2-ylpiperazin-1-yl)phenyl]phenyl]ethoxymethyl]phenyl]-5-pyridin-3-ylpentan-3-one |
|---|---|
| PubChem CID | 158415746 |
| Molecular Formula | C38H45N3O2 |
| Molecular Weight | 575.80 g/mol |
| Exact Mass | 575.35 |
| IUPAC Name | 1-[4-[2-[2-[3-(4-propan-2-ylpiperazin-1-yl)phenyl]phenyl]ethoxymethyl]phenyl]-5-pyridin-3-ylpentan-3-one |
| SMILES | CC(C)N1CCN(c2cccc(-c3ccccc3CCOCc3ccc(CCC(=O)CCc4cccnc4)cc3)c2)CC1 |
| InChI | InChI=1S/C38H45N3O2/c1-30(2)40-22-24-41(25-23-40)36-10-5-9-35(27-36)38-11-4-3-8-34(38)20-26-43-29-33-14-12-31(13-15-33)16-18-37(42)19-17-32-7-6-21-39-28-32/h3-15,21,27-28,30H,16-20,22-26,29H2,1-2H3 |
| InChIKey | LHDAUIVEPUOROI-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.80 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|