About copper;indium(3+);thiophosphate
copper;indium(3+);thiophosphate (PubChem CID 158417872) has the molecular formula CuInO3PS+2
and a molecular weight of 289.40 g/mol. Its IUPAC name is copper;indium(3+);thiophosphate.
Molecular Properties
| Compound Name | copper;indium(3+);thiophosphate |
| PubChem CID | 158417872 |
| Molecular Formula | CuInO3PS+2 |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 288.76 |
| IUPAC Name | copper;indium(3+);thiophosphate |
| SMILES | [Cu+2].[In+3].[O-]P([O-])([O-])=S |
| InChI | InChI=1S/Cu.In.H3O3PS/c;;1-4(2,3)5/h;;(H3,1,2,3,5)/q+2;+3;/p-3 |
| InChIKey | HACVPBPJHIPGHT-UHFFFAOYSA-K |
| XLogP | -3.09 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze copper;indium(3+);thiophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;indium(3+);thiophosphate?
The IUPAC name of copper;indium(3+);thiophosphate (CID 158417872) is copper;indium(3+);thiophosphate.
What is the SMILES notation for copper;indium(3+);thiophosphate?
The canonical SMILES for copper;indium(3+);thiophosphate is [Cu+2].[In+3].[O-]P([O-])([O-])=S.
What is the InChIKey of copper;indium(3+);thiophosphate?
The InChIKey is HACVPBPJHIPGHT-UHFFFAOYSA-K. The full InChI is InChI=1S/Cu.In.H3O3PS/c;;1-4(2,3)5/h;;(H3,1,2,3,5)/q+2;+3;/p-3.
What are the key properties of copper;indium(3+);thiophosphate?
copper;indium(3+);thiophosphate has a molecular weight of 289.40 g/mol, XLogP of -3.09, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper;indium(3+);thiophosphate is sourced from PubChem (CID 158417872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).