About copper;carbamate;thiophosphate
copper;carbamate;thiophosphate (PubChem CID 157426335) has the molecular formula CH2CuNO5PS-4
and a molecular weight of 234.62 g/mol. Its IUPAC name is copper;carbamate;thiophosphate.
Molecular Properties
| Compound Name | copper;carbamate;thiophosphate |
| PubChem CID | 157426335 |
| Molecular Formula | CH2CuNO5PS-4 |
| Molecular Weight | 234.62 g/mol |
| Exact Mass | 233.87 |
| IUPAC Name | copper;carbamate;thiophosphate |
| SMILES | NC(=O)[O-].[Cu].[O-]P([O-])([O-])=S |
| InChI | InChI=1S/CH3NO2.Cu.H3O3PS/c2-1(3)4;;1-4(2,3)5/h2H2,(H,3,4);;(H3,1,2,3,5)/p-4 |
| InChIKey | IUIBGOPYUSBDMM-UHFFFAOYSA-J |
| XLogP | -4.42 |
| TPSA | 135.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.62 |
| LogP ≤ 5 | -4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze copper;carbamate;thiophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;carbamate;thiophosphate?
The IUPAC name of copper;carbamate;thiophosphate (CID 157426335) is copper;carbamate;thiophosphate.
What is the SMILES notation for copper;carbamate;thiophosphate?
The canonical SMILES for copper;carbamate;thiophosphate is NC(=O)[O-].[Cu].[O-]P([O-])([O-])=S.
What is the InChIKey of copper;carbamate;thiophosphate?
The InChIKey is IUIBGOPYUSBDMM-UHFFFAOYSA-J. The full InChI is InChI=1S/CH3NO2.Cu.H3O3PS/c2-1(3)4;;1-4(2,3)5/h2H2,(H,3,4);;(H3,1,2,3,5)/p-4.
What are the key properties of copper;carbamate;thiophosphate?
copper;carbamate;thiophosphate has a molecular weight of 234.62 g/mol, XLogP of -4.42, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for copper;carbamate;thiophosphate is sourced from PubChem (CID 157426335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).