About (E)-but-2-enedioate carbamate
(E)-but-2-enedioate carbamate (PubChem CID 19782510) has the molecular formula C5H4NO6-3
and a molecular weight of 174.09 g/mol. Its IUPAC name is (E)-but-2-enedioate carbamate.
Molecular Properties
| Compound Name | (E)-but-2-enedioate carbamate |
| PubChem CID | 19782510 |
| Molecular Formula | C5H4NO6-3 |
| Molecular Weight | 174.09 g/mol |
| Exact Mass | 174.01 |
| IUPAC Name | (E)-but-2-enedioate carbamate |
| SMILES | NC(=O)[O-].O=C([O-])/C=C/C(=O)[O-] |
| InChI | InChI=1S/C4H4O4.CH3NO2/c5-3(6)1-2-4(7)8;2-1(3)4/h1-2H,(H,5,6)(H,7,8);2H2,(H,3,4)/p-3/b2-1+; |
| InChIKey | PTPQTHDPJCQFOC-TYYBGVCCSA-K |
| XLogP | -4.67 |
| TPSA | 146.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.09 |
| LogP ≤ 5 | -4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioate carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioate carbamate?
The IUPAC name of (E)-but-2-enedioate carbamate (CID 19782510) is (E)-but-2-enedioate carbamate.
What is the SMILES notation for (E)-but-2-enedioate carbamate?
The canonical SMILES for (E)-but-2-enedioate carbamate is NC(=O)[O-].O=C([O-])/C=C/C(=O)[O-].
What is the InChIKey of (E)-but-2-enedioate carbamate?
The InChIKey is PTPQTHDPJCQFOC-TYYBGVCCSA-K. The full InChI is InChI=1S/C4H4O4.CH3NO2/c5-3(6)1-2-4(7)8;2-1(3)4/h1-2H,(H,5,6)(H,7,8);2H2,(H,3,4)/p-3/b2-1+;.
What are the key properties of (E)-but-2-enedioate carbamate?
(E)-but-2-enedioate carbamate has a molecular weight of 174.09 g/mol, XLogP of -4.67, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioate carbamate is sourced from PubChem (CID 19782510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).