About nickel(2+) dicarbamate
nickel(2+) dicarbamate (PubChem CID 87136196) has the molecular formula C2H4N2NiO4
and a molecular weight of 178.76 g/mol. Its IUPAC name is nickel(2+) dicarbamate.
Molecular Properties
| Compound Name | nickel(2+) dicarbamate |
| PubChem CID | 87136196 |
| Molecular Formula | C2H4N2NiO4 |
| Molecular Weight | 178.76 g/mol |
| Exact Mass | 177.95 |
| IUPAC Name | nickel(2+) dicarbamate |
| SMILES | NC(=O)[O-].NC(=O)[O-].[Ni+2] |
| InChI | InChI=1S/2CH3NO2.Ni/c2*2-1(3)4;/h2*2H2,(H,3,4);/q;;+2/p-2 |
| InChIKey | OTHOHYAKTRGDLP-UHFFFAOYSA-L |
| XLogP | -3.43 |
| TPSA | 132.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.76 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze nickel(2+) dicarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel(2+) dicarbamate?
The IUPAC name of nickel(2+) dicarbamate (CID 87136196) is nickel(2+) dicarbamate.
What is the SMILES notation for nickel(2+) dicarbamate?
The canonical SMILES for nickel(2+) dicarbamate is NC(=O)[O-].NC(=O)[O-].[Ni+2].
What is the InChIKey of nickel(2+) dicarbamate?
The InChIKey is OTHOHYAKTRGDLP-UHFFFAOYSA-L. The full InChI is InChI=1S/2CH3NO2.Ni/c2*2-1(3)4;/h2*2H2,(H,3,4);/q;;+2/p-2.
What are the key properties of nickel(2+) dicarbamate?
nickel(2+) dicarbamate has a molecular weight of 178.76 g/mol, XLogP of -3.43, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nickel(2+) dicarbamate is sourced from PubChem (CID 87136196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).