C20H29BN3O4 — CID 158419046
CID 158419046 (PubChem CID 158419046) has the molecular formula C20H29BN3O4 and a molecular weight of 386.28 g/mol.
| Compound Name | CID 158419046 |
|---|---|
| PubChem CID | 158419046 |
| Molecular Formula | C20H29BN3O4 |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | — |
| SMILES | COC12CC3CC(C1)CC([C@H](N[B]C=O)C(=O)N1C4C[C@H]4C[C@H]1C(N)=O)(C3)C2 |
| InChI | InChI=1S/C20H29BN3O4/c1-28-20-7-11-2-12(8-20)6-19(5-11,9-20)16(23-21-10-25)18(27)24-14-3-13(14)4-15(24)17(22)26/h10-16,23H,2-9H2,1H3,(H2,22,26)/t11?,12?,13-,14?,15-,16+,19?,20?/m0/s1 |
| InChIKey | IJYMYOMCJQIBGI-NCSKGSJWSA-N |
| XLogP | 0.21 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|