C37H41N3O3 — CID 121454404
(1S,3S,5S)-2-[(2S)-2-(3-hydroxy-1-adamantyl)-2-(tritylamino)acetyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 121454404) has the molecular formula C37H41N3O3 and a molecular weight of 575.75 g/mol. Its IUPAC name is (1S,3S,5S)-2-[(2S)-2-(3-hydroxy-1-adamantyl)-2-(tritylamino)acetyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | (1S,3S,5S)-2-[(2S)-2-(3-hydroxy-1-adamantyl)-2-(tritylamino)acetyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 121454404 |
| Molecular Formula | C37H41N3O3 |
| Molecular Weight | 575.75 g/mol |
| Exact Mass | 575.31 |
| IUPAC Name | (1S,3S,5S)-2-[(2S)-2-(3-hydroxy-1-adamantyl)-2-(tritylamino)acetyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | NC(=O)[C@@H]1C[C@@H]2C[C@@H]2N1C(=O)[C@@H](NC(c1ccccc1)(c1ccccc1)c1ccccc1)C12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C37H41N3O3/c38-33(41)31-18-26-17-30(26)40(31)34(42)32(35-19-24-16-25(20-35)22-36(43,21-24)23-35)39-37(27-10-4-1-5-11-27,28-12-6-2-7-13-28)29-14-8-3-9-15-29/h1-15,24-26,30-32,39,43H,16-23H2,(H2,38,41)/t24?,25?,26-,30-,31-,32+,35?,36?/m0/s1 |
| InChIKey | BVGYBFPKWUHIAV-BYIMYDFZSA-N |
| XLogP | 4.74 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.75 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|