C18H24N2O4 — CID 140711071
(1S,5S)-2-[2-[(5S,7S)-3-hydroxy-1-adamantyl]-2-oxoacetyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 140711071) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is (1S,5S)-2-[2-[(5S,7S)-3-hydroxy-1-adamantyl]-2-oxoacetyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | (1S,5S)-2-[2-[(5S,7S)-3-hydroxy-1-adamantyl]-2-oxoacetyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 140711071 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | (1S,5S)-2-[2-[(5S,7S)-3-hydroxy-1-adamantyl]-2-oxoacetyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | NC(=O)C1C[C@@H]2C[C@@H]2N1C(=O)C(=O)C12C[C@@H]3C[C@H](CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C18H24N2O4/c19-15(22)13-3-11-2-12(11)20(13)16(23)14(21)17-4-9-1-10(5-17)7-18(24,6-9)8-17/h9-13,24H,1-8H2,(H2,19,22)/t9-,10-,11-,12-,13?,17?,18?/m0/s1 |
| InChIKey | WOWKHVHPFZGCSV-ZKDCJXQASA-N |
| XLogP | 0.36 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|