C30H22N6OS — CID 158424479
5,6-diphenyl-2H-1,2,4-triazine-3-thione;5,6-diphenyl-2H-1,2,4-triazin-3-one (PubChem CID 158424479) has the molecular formula C30H22N6OS and a molecular weight of 514.61 g/mol. Its IUPAC name is 5,6-diphenyl-2H-1,2,4-triazine-3-thione;5,6-diphenyl-2H-1,2,4-triazin-3-one.
| Compound Name | 5,6-diphenyl-2H-1,2,4-triazine-3-thione;5,6-diphenyl-2H-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 158424479 |
| Molecular Formula | C30H22N6OS |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | 5,6-diphenyl-2H-1,2,4-triazine-3-thione;5,6-diphenyl-2H-1,2,4-triazin-3-one |
| SMILES | O=c1nc(-c2ccccc2)c(-c2ccccc2)n[nH]1.S=c1nc(-c2ccccc2)c(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C15H11N3O.C15H11N3S/c2*19-15-16-13(11-7-3-1-4-8-11)14(17-18-15)12-9-5-2-6-10-12/h2*1-10H,(H,16,18,19) |
| InChIKey | HAWQACBZTYLUAW-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|