C29H56O8Si2 — CID 158424677
tert-butyl 2,2-dimethylbutanoate;3,4-dimethyloxolane-2,5-dione;2-methylbutyl 2,2,6,6-tetramethyl-1,2,6-oxadisilinane-4-carboxylate (PubChem CID 158424677) has the molecular formula C29H56O8Si2 and a molecular weight of 588.93 g/mol. Its IUPAC name is tert-butyl 2,2-dimethylbutanoate;3,4-dimethyloxolane-2,5-dione;2-methylbutyl 2,2,6,6-tetramethyl-1,2,6-oxadisilinane-4-carboxylate.
| Compound Name | tert-butyl 2,2-dimethylbutanoate;3,4-dimethyloxolane-2,5-dione;2-methylbutyl 2,2,6,6-tetramethyl-1,2,6-oxadisilinane-4-carboxylate |
|---|---|
| PubChem CID | 158424677 |
| Molecular Formula | C29H56O8Si2 |
| Molecular Weight | 588.93 g/mol |
| Exact Mass | 588.35 |
| IUPAC Name | tert-butyl 2,2-dimethylbutanoate;3,4-dimethyloxolane-2,5-dione;2-methylbutyl 2,2,6,6-tetramethyl-1,2,6-oxadisilinane-4-carboxylate |
| SMILES | CC1C(=O)OC(=O)C1C.CCC(C)(C)C(=O)OC(C)(C)C.CCC(C)COC(=O)C1C[Si](C)(C)O[Si](C)(C)C1 |
| InChI | InChI=1S/C13H28O3Si2.C10H20O2.C6H8O3/c1-7-11(2)8-15-13(14)12-9-17(3,4)16-18(5,6)10-12;1-7-10(5,6)8(11)12-9(2,3)4;1-3-4(2)6(8)9-5(3)7/h11-12H,7-10H2,1-6H3;7H2,1-6H3;3-4H,1-2H3 |
| InChIKey | HAXGFMIZFBBZOF-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.93 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|