C13H13F3O6S3 — CID 158426472
2-methyl-3-(4-methylthiophen-2-yl)benzenesulfonic acid;trifluoromethanesulfonic acid (PubChem CID 158426472) has the molecular formula C13H13F3O6S3 and a molecular weight of 418.44 g/mol. Its IUPAC name is 2-methyl-3-(4-methylthiophen-2-yl)benzenesulfonic acid;trifluoromethanesulfonic acid.
| Compound Name | 2-methyl-3-(4-methylthiophen-2-yl)benzenesulfonic acid;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 158426472 |
| Molecular Formula | C13H13F3O6S3 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | 2-methyl-3-(4-methylthiophen-2-yl)benzenesulfonic acid;trifluoromethanesulfonic acid |
| SMILES | Cc1csc(-c2cccc(S(=O)(=O)O)c2C)c1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C12H12O3S2.CHF3O3S/c1-8-6-11(16-7-8)10-4-3-5-12(9(10)2)17(13,14)15;2-1(3,4)8(5,6)7/h3-7H,1-2H3,(H,13,14,15);(H,5,6,7) |
| InChIKey | HBCNCKBXIOVVMP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|