C10H12O6S2 — CID 163516308
2-methyl-3-[(E)-1-sulfoprop-1-enyl]benzenesulfonic acid (PubChem CID 163516308) has the molecular formula C10H12O6S2 and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-methyl-3-[(E)-1-sulfoprop-1-enyl]benzenesulfonic acid.
| Compound Name | 2-methyl-3-[(E)-1-sulfoprop-1-enyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 163516308 |
| Molecular Formula | C10H12O6S2 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 2-methyl-3-[(E)-1-sulfoprop-1-enyl]benzenesulfonic acid |
| SMILES | C/C=C(\c1cccc(S(=O)(=O)O)c1C)S(=O)(=O)O |
| InChI | InChI=1S/C10H12O6S2/c1-3-9(17(11,12)13)8-5-4-6-10(7(8)2)18(14,15)16/h3-6H,1-2H3,(H,11,12,13)(H,14,15,16)/b9-3+ |
| InChIKey | DHBCNNDKHYEXNS-YCRREMRBSA-N |
| XLogP | 1.49 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|