C46H54Cl2N6O3 — CID 158427328
5-chloro-N-[4-[[cyclohexyl(methyl)amino]methyl]phenyl]-1H-indole-2-carboxamide;5-chloro-1H-indole-2-carboxylic acid;4-[[cyclohexyl(methyl)amino]methyl]aniline (PubChem CID 158427328) has the molecular formula C46H54Cl2N6O3 and a molecular weight of 809.88 g/mol. Its IUPAC name is 5-chloro-N-[4-[[cyclohexyl(methyl)amino]methyl]phenyl]-1H-indole-2-carboxamide;5-chloro-1H-indole-2-carboxylic acid;4-[[cyclohexyl(methyl)amino]methyl]aniline.
| Compound Name | 5-chloro-N-[4-[[cyclohexyl(methyl)amino]methyl]phenyl]-1H-indole-2-carboxamide;5-chloro-1H-indole-2-carboxylic acid;4-[[cyclohexyl(methyl)amino]methyl]aniline |
|---|---|
| PubChem CID | 158427328 |
| Molecular Formula | C46H54Cl2N6O3 |
| Molecular Weight | 809.88 g/mol |
| Exact Mass | 808.36 |
| IUPAC Name | 5-chloro-N-[4-[[cyclohexyl(methyl)amino]methyl]phenyl]-1H-indole-2-carboxamide;5-chloro-1H-indole-2-carboxylic acid;4-[[cyclohexyl(methyl)amino]methyl]aniline |
| SMILES | CN(Cc1ccc(N)cc1)C1CCCCC1.CN(Cc1ccc(NC(=O)c2cc3cc(Cl)ccc3[nH]2)cc1)C1CCCCC1.O=C(O)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C23H26ClN3O.C14H22N2.C9H6ClNO2/c1-27(20-5-3-2-4-6-20)15-16-7-10-19(11-8-16)25-23(28)22-14-17-13-18(24)9-12-21(17)26-22;1-16(14-5-3-2-4-6-14)11-12-7-9-13(15)10-8-12;10-6-1-2-7-5(3-6)4-8(11-7)9(12)13/h7-14,20,26H,2-6,15H2,1H3,(H,25,28);7-10,14H,2-6,11,15H2,1H3;1-4,11H,(H,12,13) |
| InChIKey | HBFIRKQRVXRSDP-UHFFFAOYSA-N |
| XLogP | 11.39 |
| TPSA | 130.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.88 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|