C27H22F5N3O2 — CID 158427589
1-(2,4-difluorophenyl)-6-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]hexan-2-one (PubChem CID 158427589) has the molecular formula C27H22F5N3O2 and a molecular weight of 515.48 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-6-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]hexan-2-one.
| Compound Name | 1-(2,4-difluorophenyl)-6-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]hexan-2-one |
|---|---|
| PubChem CID | 158427589 |
| Molecular Formula | C27H22F5N3O2 |
| Molecular Weight | 515.48 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | 1-(2,4-difluorophenyl)-6-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]hexan-2-one |
| SMILES | O=C(CCCCc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C27H22F5N3O2/c28-21-10-9-20(25(29)16-21)15-23(36)4-2-1-3-18-5-7-19(8-6-18)26-33-17-35(34-26)22-11-13-24(14-12-22)37-27(30,31)32/h5-14,16-17H,1-4,15H2 |
| InChIKey | HBGBURCQCFRQOL-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.48 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|