C30H27F4N3O2S — CID 158789934
6-(4-fluoro-2-propan-2-ylphenyl)-5-sulfanylidene-1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]hexan-3-one (PubChem CID 158789934) has the molecular formula C30H27F4N3O2S and a molecular weight of 569.62 g/mol. Its IUPAC name is 6-(4-fluoro-2-propan-2-ylphenyl)-5-sulfanylidene-1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]hexan-3-one.
| Compound Name | 6-(4-fluoro-2-propan-2-ylphenyl)-5-sulfanylidene-1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]hexan-3-one |
|---|---|
| PubChem CID | 158789934 |
| Molecular Formula | C30H27F4N3O2S |
| Molecular Weight | 569.62 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | 6-(4-fluoro-2-propan-2-ylphenyl)-5-sulfanylidene-1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]hexan-3-one |
| SMILES | CC(C)c1cc(F)ccc1CC(=S)CC(=O)CCc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C30H27F4N3O2S/c1-19(2)28-16-23(31)9-8-22(28)15-27(40)17-25(38)12-5-20-3-6-21(7-4-20)29-35-18-37(36-29)24-10-13-26(14-11-24)39-30(32,33)34/h3-4,6-11,13-14,16,18-19H,5,12,15,17H2,1-2H3 |
| InChIKey | ISDLLZYGBDBCKD-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.62 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|