C22H29N5O19 — CID 158428578
2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,7-dihydropurine-6,8-dione;bis(2-hydroxypropane-1,2,3-tricarboxylic acid) (PubChem CID 158428578) has the molecular formula C22H29N5O19 and a molecular weight of 667.49 g/mol. Its IUPAC name is 2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,7-dihydropurine-6,8-dione;bis(2-hydroxypropane-1,2,3-tricarboxylic acid).
| Compound Name | 2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,7-dihydropurine-6,8-dione;bis(2-hydroxypropane-1,2,3-tricarboxylic acid) |
|---|---|
| PubChem CID | 158428578 |
| Molecular Formula | C22H29N5O19 |
| Molecular Weight | 667.49 g/mol |
| Exact Mass | 667.15 |
| IUPAC Name | 2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,7-dihydropurine-6,8-dione;bis(2-hydroxypropane-1,2,3-tricarboxylic acid) |
| SMILES | Nc1nc2c([nH]c(=O)n2[C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)[nH]1.O=C(O)CC(O)(CC(=O)O)C(=O)O.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H13N5O5.2C6H8O7/c11-9-13-7-6(8(18)14-9)12-10(19)15(7)5-1-3(17)4(2-16)20-5;2*7-3(8)1-6(13,5(11)12)2-4(9)10/h3-5,16-17H,1-2H2,(H,12,19)(H3,11,13,14,18);2*13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/t3-,4+,5+;;/m0../s1 |
| InChIKey | HBJGLNZSPJETLY-GBQQWJQBSA-N |
| XLogP | -4.86 |
| TPSA | 423.51 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.49 |
| LogP ≤ 5 | -4.86 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 16 |