C15H20N6O8 — CID 136654875
5-[[(2R,3S,5R)-5-(2-amino-6,8-dioxo-1,7-dihydropurin-9-yl)-3-hydroxyoxolan-2-yl]methoxyamino]-4-oxopentanoic acid (PubChem CID 136654875) has the molecular formula C15H20N6O8 and a molecular weight of 412.36 g/mol. Its IUPAC name is 5-[[(2R,3S,5R)-5-(2-amino-6,8-dioxo-1,7-dihydropurin-9-yl)-3-hydroxyoxolan-2-yl]methoxyamino]-4-oxopentanoic acid.
| Compound Name | 5-[[(2R,3S,5R)-5-(2-amino-6,8-dioxo-1,7-dihydropurin-9-yl)-3-hydroxyoxolan-2-yl]methoxyamino]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 136654875 |
| Molecular Formula | C15H20N6O8 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 5-[[(2R,3S,5R)-5-(2-amino-6,8-dioxo-1,7-dihydropurin-9-yl)-3-hydroxyoxolan-2-yl]methoxyamino]-4-oxopentanoic acid |
| SMILES | Nc1nc2c([nH]c(=O)n2[C@H]2C[C@H](O)[C@@H](CONCC(=O)CCC(=O)O)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C15H20N6O8/c16-14-19-12-11(13(26)20-14)18-15(27)21(12)9-3-7(23)8(29-9)5-28-17-4-6(22)1-2-10(24)25/h7-9,17,23H,1-5H2,(H,18,27)(H,24,25)(H3,16,19,20,26)/t7-,8+,9+/m0/s1 |
| InChIKey | HRPAKCBVRHIFJW-DJLDLDEBSA-N |
| XLogP | -2.40 |
| TPSA | 214.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|