C52H27N5S2 — CID 158431195
7-isocyano-9-[8-[8-(2-isocyano-7-methylcarbazol-9-yl)dibenzothiophen-2-yl]dibenzothiophen-2-yl]carbazole-2-carbonitrile (PubChem CID 158431195) has the molecular formula C52H27N5S2 and a molecular weight of 785.96 g/mol. Its IUPAC name is 7-isocyano-9-[8-[8-(2-isocyano-7-methylcarbazol-9-yl)dibenzothiophen-2-yl]dibenzothiophen-2-yl]carbazole-2-carbonitrile.
| Compound Name | 7-isocyano-9-[8-[8-(2-isocyano-7-methylcarbazol-9-yl)dibenzothiophen-2-yl]dibenzothiophen-2-yl]carbazole-2-carbonitrile |
|---|---|
| PubChem CID | 158431195 |
| Molecular Formula | C52H27N5S2 |
| Molecular Weight | 785.96 g/mol |
| Exact Mass | 785.17 |
| IUPAC Name | 7-isocyano-9-[8-[8-(2-isocyano-7-methylcarbazol-9-yl)dibenzothiophen-2-yl]dibenzothiophen-2-yl]carbazole-2-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c3ccc(C)cc3n(-c3ccc4sc5ccc(-c6ccc7sc8ccc(-n9c%10cc(C#N)ccc%10c%10ccc([N+]#[C-])cc%109)cc8c7c6)cc5c4c3)c2c1 |
| InChI | InChI=1S/C52H27N5S2/c1-29-4-12-37-39-14-8-33(54-2)24-47(39)56(45(37)20-29)35-10-18-51-43(26-35)41-22-31(6-16-49(41)58-51)32-7-17-50-42(23-32)44-27-36(11-19-52(44)59-50)57-46-21-30(28-53)5-13-38(46)40-15-9-34(55-3)25-48(40)57/h4-27H,1H3 |
| InChIKey | JJEUFFMQKSBRLE-UHFFFAOYSA-N |
| XLogP | 15.57 |
| TPSA | 42.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.96 |
| LogP ≤ 5 | 15.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|