C39H26N4O2+2 — CID 158433506
5-methyl-4-(4-phenylphenyl)-3,12-dioxa-6,18-diaza-5,29-diazonianonacyclo[15.12.1.11,7.118,25.02,6.013,30.019,24.011,32.029,31]dotriaconta-4,7(32),8,10,13,15,17(30),19,21,23,25(31),26,28-tridecaene (PubChem CID 158433506) has the molecular formula C39H26N4O2+2 and a molecular weight of 582.66 g/mol. Its IUPAC name is 5-methyl-4-(4-phenylphenyl)-3,12-dioxa-6,18-diaza-5,29-diazonianonacyclo[15.12.1.11,7.118,25.02,6.013,30.019,24.011,32.029,31]dotriaconta-4,7(32),8,10,13,15,17(30),19,21,23,25(31),26,28-tridecaene.
| Compound Name | 5-methyl-4-(4-phenylphenyl)-3,12-dioxa-6,18-diaza-5,29-diazonianonacyclo[15.12.1.11,7.118,25.02,6.013,30.019,24.011,32.029,31]dotriaconta-4,7(32),8,10,13,15,17(30),19,21,23,25(31),26,28-tridecaene |
|---|---|
| PubChem CID | 158433506 |
| Molecular Formula | C39H26N4O2+2 |
| Molecular Weight | 582.66 g/mol |
| Exact Mass | 582.20 |
| IUPAC Name | 5-methyl-4-(4-phenylphenyl)-3,12-dioxa-6,18-diaza-5,29-diazonianonacyclo[15.12.1.11,7.118,25.02,6.013,30.019,24.011,32.029,31]dotriaconta-4,7(32),8,10,13,15,17(30),19,21,23,25(31),26,28-tridecaene |
| SMILES | C[N+]1=C(c2ccc(-c3ccccc3)cc2)OC2N1c1cccc3c1C21c2c(cccc2-n2c4ccccc4c4ccc[n+]1c42)O3 |
| InChI | InChI=1S/C39H26N4O2/c1-40-37(26-21-19-25(20-22-26)24-10-3-2-4-11-24)45-38-39-34-30(15-7-17-32(34)44-33-18-8-16-31(35(33)39)43(38)40)42-29-14-6-5-12-27(29)28-13-9-23-41(39)36(28)42/h2-23,38H,1H3/q+2 |
| InChIKey | FPOSNFQYKXQJOH-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 33.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.66 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|