C38H23N4O2+ — CID 158889082
4-(4-phenylphenyl)-3,12-dioxa-5,6,18-triaza-29-azonianonacyclo[15.12.1.11,7.118,25.02,6.013,30.019,24.011,32.029,31]dotriaconta-4,7(32),8,10,13,15,17(30),19,21,23,25(31),26,28-tridecaene (PubChem CID 158889082) has the molecular formula C38H23N4O2+ and a molecular weight of 567.63 g/mol. Its IUPAC name is 4-(4-phenylphenyl)-3,12-dioxa-5,6,18-triaza-29-azonianonacyclo[15.12.1.11,7.118,25.02,6.013,30.019,24.011,32.029,31]dotriaconta-4,7(32),8,10,13,15,17(30),19,21,23,25(31),26,28-tridecaene.
| Compound Name | 4-(4-phenylphenyl)-3,12-dioxa-5,6,18-triaza-29-azonianonacyclo[15.12.1.11,7.118,25.02,6.013,30.019,24.011,32.029,31]dotriaconta-4,7(32),8,10,13,15,17(30),19,21,23,25(31),26,28-tridecaene |
|---|---|
| PubChem CID | 158889082 |
| Molecular Formula | C38H23N4O2+ |
| Molecular Weight | 567.63 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | 4-(4-phenylphenyl)-3,12-dioxa-5,6,18-triaza-29-azonianonacyclo[15.12.1.11,7.118,25.02,6.013,30.019,24.011,32.029,31]dotriaconta-4,7(32),8,10,13,15,17(30),19,21,23,25(31),26,28-tridecaene |
| SMILES | c1ccc(-c2ccc(C3=NN4c5cccc6c5C5(c7c(cccc7-n7c8ccccc8c8ccc[n+]5c87)O6)C4O3)cc2)cc1 |
| InChI | InChI=1S/C38H23N4O2/c1-2-9-23(10-3-1)24-18-20-25(21-19-24)35-39-42-30-15-7-17-32-34(30)38(37(42)44-35)33-29(14-6-16-31(33)43-32)41-28-13-5-4-11-26(28)27-12-8-22-40(38)36(27)41/h1-22,37H/q+1 |
| InChIKey | ZLFSJWDFGFZMBJ-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 42.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.63 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|