C14H21ClN4O4S2 — CID 158434444
N-(2-aminophenyl)methanesulfonamide;benzene-1,2-diamine;methanesulfonyl chloride (PubChem CID 158434444) has the molecular formula C14H21ClN4O4S2 and a molecular weight of 408.93 g/mol. Its IUPAC name is N-(2-aminophenyl)methanesulfonamide;benzene-1,2-diamine;methanesulfonyl chloride.
| Compound Name | N-(2-aminophenyl)methanesulfonamide;benzene-1,2-diamine;methanesulfonyl chloride |
|---|---|
| PubChem CID | 158434444 |
| Molecular Formula | C14H21ClN4O4S2 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | N-(2-aminophenyl)methanesulfonamide;benzene-1,2-diamine;methanesulfonyl chloride |
| SMILES | CS(=O)(=O)Cl.CS(=O)(=O)Nc1ccccc1N.Nc1ccccc1N |
| InChI | InChI=1S/C7H10N2O2S.C6H8N2.CH3ClO2S/c1-12(10,11)9-7-5-3-2-4-6(7)8;7-5-3-1-2-4-6(5)8;1-5(2,3)4/h2-5,9H,8H2,1H3;1-4H,7-8H2;1H3 |
| InChIKey | HCAZEHHFNVRNRL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 158.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|