C14H22OS2 — CID 158437250
2-[3-(3,3-dimethylbutylsulfanyl)phenyl]sulfanylethanol (PubChem CID 158437250) has the molecular formula C14H22OS2 and a molecular weight of 270.46 g/mol. Its IUPAC name is 2-[3-(3,3-dimethylbutylsulfanyl)phenyl]sulfanylethanol.
| Compound Name | 2-[3-(3,3-dimethylbutylsulfanyl)phenyl]sulfanylethanol |
|---|---|
| PubChem CID | 158437250 |
| Molecular Formula | C14H22OS2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-[3-(3,3-dimethylbutylsulfanyl)phenyl]sulfanylethanol |
| SMILES | CC(C)(C)CCSc1cccc(SCCO)c1 |
| InChI | InChI=1S/C14H22OS2/c1-14(2,3)7-9-16-12-5-4-6-13(11-12)17-10-8-15/h4-6,11,15H,7-10H2,1-3H3 |
| InChIKey | HJHYARIPVFUWMQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |