About 2-[3-[methyl(methylidene)-λ4-sulfanyl]oxyphenyl]sulfanylethanol
2-[3-[methyl(methylidene)-λ4-sulfanyl]oxyphenyl]sulfanylethanol (PubChem CID 58107240) has the molecular formula C10H14O2S2
and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-[3-[methyl(methylidene)-λ4-sulfanyl]oxyphenyl]sulfanylethanol.
Molecular Properties
| Compound Name | 2-[3-[methyl(methylidene)-λ4-sulfanyl]oxyphenyl]sulfanylethanol |
| PubChem CID | 58107240 |
| Molecular Formula | C10H14O2S2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 2-[3-[methyl(methylidene)-λ4-sulfanyl]oxyphenyl]sulfanylethanol |
| SMILES | C=S(C)Oc1cccc(SCCO)c1 |
| InChI | InChI=1S/C10H14O2S2/c1-14(2)12-9-4-3-5-10(8-9)13-7-6-11/h3-5,8,11H,1,6-7H2,2H3 |
| InChIKey | CYIPDLRTVWSHRU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[methyl(methylidene)-λ4-sulfanyl]oxyphenyl]sulfanylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[methyl(methylidene)-λ4-sulfanyl]oxyphenyl]sulfanylethanol?
The IUPAC name of 2-[3-[methyl(methylidene)-λ4-sulfanyl]oxyphenyl]sulfanylethanol (CID 58107240) is 2-[3-[methyl(methylidene)-λ4-sulfanyl]oxyphenyl]sulfanylethanol.
What is the SMILES notation for 2-[3-[methyl(methylidene)-λ4-sulfanyl]oxyphenyl]sulfanylethanol?
The canonical SMILES for 2-[3-[methyl(methylidene)-λ4-sulfanyl]oxyphenyl]sulfanylethanol is C=S(C)Oc1cccc(SCCO)c1.
What is the InChIKey of 2-[3-[methyl(methylidene)-λ4-sulfanyl]oxyphenyl]sulfanylethanol?
The InChIKey is CYIPDLRTVWSHRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2S2/c1-14(2)12-9-4-3-5-10(8-9)13-7-6-11/h3-5,8,11H,1,6-7H2,2H3.
What are the key properties of 2-[3-[methyl(methylidene)-λ4-sulfanyl]oxyphenyl]sulfanylethanol?
2-[3-[methyl(methylidene)-λ4-sulfanyl]oxyphenyl]sulfanylethanol has a molecular weight of 230.35 g/mol, XLogP of 2.40, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[methyl(methylidene)-λ4-sulfanyl]oxyphenyl]sulfanylethanol is sourced from PubChem (CID 58107240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).