C19H16FNO5 — CID 158445126
methyl 7-fluoro-1-[(4-methoxyphenyl)methyl]-2,3-dioxo-4H-quinoline-6-carboxylate (PubChem CID 158445126) has the molecular formula C19H16FNO5 and a molecular weight of 357.34 g/mol. Its IUPAC name is methyl 7-fluoro-1-[(4-methoxyphenyl)methyl]-2,3-dioxo-4H-quinoline-6-carboxylate.
| Compound Name | methyl 7-fluoro-1-[(4-methoxyphenyl)methyl]-2,3-dioxo-4H-quinoline-6-carboxylate |
|---|---|
| PubChem CID | 158445126 |
| Molecular Formula | C19H16FNO5 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | methyl 7-fluoro-1-[(4-methoxyphenyl)methyl]-2,3-dioxo-4H-quinoline-6-carboxylate |
| SMILES | COC(=O)c1cc2c(cc1F)N(Cc1ccc(OC)cc1)C(=O)C(=O)C2 |
| InChI | InChI=1S/C19H16FNO5/c1-25-13-5-3-11(4-6-13)10-21-16-9-15(20)14(19(24)26-2)7-12(16)8-17(22)18(21)23/h3-7,9H,8,10H2,1-2H3 |
| InChIKey | HDHJZOVUAZJGGY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|