C19H19NO6S — CID 165114030
methyl 4-[(7-methylsulfonyloxy-2-oxo-3,4-dihydroquinolin-1-yl)methyl]benzoate (PubChem CID 165114030) has the molecular formula C19H19NO6S and a molecular weight of 389.43 g/mol. Its IUPAC name is methyl 4-[(7-methylsulfonyloxy-2-oxo-3,4-dihydroquinolin-1-yl)methyl]benzoate.
| Compound Name | methyl 4-[(7-methylsulfonyloxy-2-oxo-3,4-dihydroquinolin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 165114030 |
| Molecular Formula | C19H19NO6S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | methyl 4-[(7-methylsulfonyloxy-2-oxo-3,4-dihydroquinolin-1-yl)methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2C(=O)CCc3ccc(OS(C)(=O)=O)cc32)cc1 |
| InChI | InChI=1S/C19H19NO6S/c1-25-19(22)15-5-3-13(4-6-15)12-20-17-11-16(26-27(2,23)24)9-7-14(17)8-10-18(20)21/h3-7,9,11H,8,10,12H2,1-2H3 |
| InChIKey | QPHFRSOKGAHODK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|