C18H12N4O4S2 — CID 158445836
2-sulfamoyl-5-(sulfinoamino)acenaphthyleno[1,2-b]quinoxaline (PubChem CID 158445836) has the molecular formula C18H12N4O4S2 and a molecular weight of 412.45 g/mol. Its IUPAC name is 2-sulfamoyl-5-(sulfinoamino)acenaphthyleno[1,2-b]quinoxaline.
| Compound Name | 2-sulfamoyl-5-(sulfinoamino)acenaphthyleno[1,2-b]quinoxaline |
|---|---|
| PubChem CID | 158445836 |
| Molecular Formula | C18H12N4O4S2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | 2-sulfamoyl-5-(sulfinoamino)acenaphthyleno[1,2-b]quinoxaline |
| SMILES | NS(=O)(=O)c1cc2c3c(cc(NS(=O)O)cc3c1)-c1nc3ccccc3nc1-2 |
| InChI | InChI=1S/C18H12N4O4S2/c19-28(25,26)11-6-9-5-10(22-27(23)24)7-12-16(9)13(8-11)18-17(12)20-14-3-1-2-4-15(14)21-18/h1-8,22H,(H,23,24)(H2,19,25,26) |
| InChIKey | XEFSGVYKTBNJNV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 135.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|