C23H20N2O7S2 — CID 158448113
2-diazo-4-methylsulfonylnaphthalen-1-one;methyl 6-methyl-5-oxo-6H-naphthalene-1-sulfonate (PubChem CID 158448113) has the molecular formula C23H20N2O7S2 and a molecular weight of 500.55 g/mol. Its IUPAC name is 2-diazo-4-methylsulfonylnaphthalen-1-one;methyl 6-methyl-5-oxo-6H-naphthalene-1-sulfonate.
| Compound Name | 2-diazo-4-methylsulfonylnaphthalen-1-one;methyl 6-methyl-5-oxo-6H-naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 158448113 |
| Molecular Formula | C23H20N2O7S2 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.07 |
| IUPAC Name | 2-diazo-4-methylsulfonylnaphthalen-1-one;methyl 6-methyl-5-oxo-6H-naphthalene-1-sulfonate |
| SMILES | COS(=O)(=O)c1cccc2c1C=CC(C)C2=O.CS(=O)(=O)C1=CC(=[N+]=[N-])C(=O)c2ccccc21 |
| InChI | InChI=1S/C12H12O4S.C11H8N2O3S/c1-8-6-7-9-10(12(8)13)4-3-5-11(9)17(14,15)16-2;1-17(15,16)10-6-9(13-12)11(14)8-5-3-2-4-7(8)10/h3-8H,1-2H3;2-6H,1H3 |
| InChIKey | HDQGSRAPDXFSDE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 148.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|