C26H35N3O10S2 — CID 158451674
2-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N,2-dimethoxy-N-methylacetamide;2-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2-methoxyacetic acid (PubChem CID 158451674) has the molecular formula C26H35N3O10S2 and a molecular weight of 613.71 g/mol. Its IUPAC name is 2-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N,2-dimethoxy-N-methylacetamide;2-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2-methoxyacetic acid.
| Compound Name | 2-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N,2-dimethoxy-N-methylacetamide;2-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2-methoxyacetic acid |
|---|---|
| PubChem CID | 158451674 |
| Molecular Formula | C26H35N3O10S2 |
| Molecular Weight | 613.71 g/mol |
| Exact Mass | 613.18 |
| IUPAC Name | 2-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N,2-dimethoxy-N-methylacetamide;2-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2-methoxyacetic acid |
| SMILES | COC(C(=O)N(C)OC)c1ccc(N2CCCS2(=O)=O)cc1.COC(C(=O)O)c1ccc(N2CCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C14H20N2O5S.C12H15NO5S/c1-15(21-3)14(17)13(20-2)11-5-7-12(8-6-11)16-9-4-10-22(16,18)19;1-18-11(12(14)15)9-3-5-10(6-4-9)13-7-2-8-19(13,16)17/h5-8,13H,4,9-10H2,1-3H3;3-6,11H,2,7-8H2,1H3,(H,14,15) |
| InChIKey | HEBONYNAWONBLV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 160.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.71 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|