C35H24Cl2F6N6O2 — CID 158456486
8-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)-1,6-naphthyridine-2-carboxamide;8-(4-chlorophenyl)-N-(3,3,3-trifluoropropyl)-1,6-naphthyridine-2-carboxamide (PubChem CID 158456486) has the molecular formula C35H24Cl2F6N6O2 and a molecular weight of 745.51 g/mol. Its IUPAC name is 8-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)-1,6-naphthyridine-2-carboxamide;8-(4-chlorophenyl)-N-(3,3,3-trifluoropropyl)-1,6-naphthyridine-2-carboxamide.
| Compound Name | 8-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)-1,6-naphthyridine-2-carboxamide;8-(4-chlorophenyl)-N-(3,3,3-trifluoropropyl)-1,6-naphthyridine-2-carboxamide |
|---|---|
| PubChem CID | 158456486 |
| Molecular Formula | C35H24Cl2F6N6O2 |
| Molecular Weight | 745.51 g/mol |
| Exact Mass | 744.12 |
| IUPAC Name | 8-(4-chlorophenyl)-N-(2,2,2-trifluoroethyl)-1,6-naphthyridine-2-carboxamide;8-(4-chlorophenyl)-N-(3,3,3-trifluoropropyl)-1,6-naphthyridine-2-carboxamide |
| SMILES | O=C(NCC(F)(F)F)c1ccc2cncc(-c3ccc(Cl)cc3)c2n1.O=C(NCCC(F)(F)F)c1ccc2cncc(-c3ccc(Cl)cc3)c2n1 |
| InChI | InChI=1S/C18H13ClF3N3O.C17H11ClF3N3O/c19-13-4-1-11(2-5-13)14-10-23-9-12-3-6-15(25-16(12)14)17(26)24-8-7-18(20,21)22;18-12-4-1-10(2-5-12)13-8-22-7-11-3-6-14(24-15(11)13)16(25)23-9-17(19,20)21/h1-6,9-10H,7-8H2,(H,24,26);1-8H,9H2,(H,23,25) |
| InChIKey | HEQAQKQQMUKPGA-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.51 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |