C21H28NO3P — CID 158458247
(2S,4R)-5-[4-(2,5-dimethylphenyl)phenyl]-2-(hydroxymethyl)-2-methyl-4-(phosphanylamino)pentanoic acid (PubChem CID 158458247) has the molecular formula C21H28NO3P and a molecular weight of 373.43 g/mol. Its IUPAC name is (2S,4R)-5-[4-(2,5-dimethylphenyl)phenyl]-2-(hydroxymethyl)-2-methyl-4-(phosphanylamino)pentanoic acid.
| Compound Name | (2S,4R)-5-[4-(2,5-dimethylphenyl)phenyl]-2-(hydroxymethyl)-2-methyl-4-(phosphanylamino)pentanoic acid |
|---|---|
| PubChem CID | 158458247 |
| Molecular Formula | C21H28NO3P |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | (2S,4R)-5-[4-(2,5-dimethylphenyl)phenyl]-2-(hydroxymethyl)-2-methyl-4-(phosphanylamino)pentanoic acid |
| SMILES | Cc1ccc(C)c(-c2ccc(C[C@H](C[C@@](C)(CO)C(=O)O)NP)cc2)c1 |
| InChI | InChI=1S/C21H28NO3P/c1-14-4-5-15(2)19(10-14)17-8-6-16(7-9-17)11-18(22-26)12-21(3,13-23)20(24)25/h4-10,18,22-23H,11-13,26H2,1-3H3,(H,24,25)/t18-,21+/m1/s1 |
| InChIKey | IINSQTYTXBNJJX-NQIIRXRSSA-N |
| XLogP | 3.73 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|