C36H38BClN6O4P2 — CID 158464062
6-chloro-N-(4-dimethylphosphorylphenyl)pyrimidin-4-amine;N-(4-dimethylphosphorylphenyl)-6-phenylpyrimidin-4-amine;phenylboronic acid (PubChem CID 158464062) has the molecular formula C36H38BClN6O4P2 and a molecular weight of 726.95 g/mol. Its IUPAC name is 6-chloro-N-(4-dimethylphosphorylphenyl)pyrimidin-4-amine;N-(4-dimethylphosphorylphenyl)-6-phenylpyrimidin-4-amine;phenylboronic acid.
| Compound Name | 6-chloro-N-(4-dimethylphosphorylphenyl)pyrimidin-4-amine;N-(4-dimethylphosphorylphenyl)-6-phenylpyrimidin-4-amine;phenylboronic acid |
|---|---|
| PubChem CID | 158464062 |
| Molecular Formula | C36H38BClN6O4P2 |
| Molecular Weight | 726.95 g/mol |
| Exact Mass | 726.22 |
| IUPAC Name | 6-chloro-N-(4-dimethylphosphorylphenyl)pyrimidin-4-amine;N-(4-dimethylphosphorylphenyl)-6-phenylpyrimidin-4-amine;phenylboronic acid |
| SMILES | CP(C)(=O)c1ccc(Nc2cc(-c3ccccc3)ncn2)cc1.CP(C)(=O)c1ccc(Nc2cc(Cl)ncn2)cc1.OB(O)c1ccccc1 |
| InChI | InChI=1S/C18H18N3OP.C12H13ClN3OP.C6H7BO2/c1-23(2,22)16-10-8-15(9-11-16)21-18-12-17(19-13-20-18)14-6-4-3-5-7-14;1-18(2,17)10-5-3-9(4-6-10)16-12-7-11(13)14-8-15-12;8-7(9)6-4-2-1-3-5-6/h3-13H,1-2H3,(H,19,20,21);3-8H,1-2H3,(H,14,15,16);1-5,8-9H |
| InChIKey | HFNLZCMFDPGTKH-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 150.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.95 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|