C26H41NO4 — CID 158474092
2-[1-[4-amino-2-(2-ethylhexyl)phenyl]-3-ethylheptylidene]propanedioic acid (PubChem CID 158474092) has the molecular formula C26H41NO4 and a molecular weight of 431.62 g/mol. Its IUPAC name is 2-[1-[4-amino-2-(2-ethylhexyl)phenyl]-3-ethylheptylidene]propanedioic acid.
| Compound Name | 2-[1-[4-amino-2-(2-ethylhexyl)phenyl]-3-ethylheptylidene]propanedioic acid |
|---|---|
| PubChem CID | 158474092 |
| Molecular Formula | C26H41NO4 |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.30 |
| IUPAC Name | 2-[1-[4-amino-2-(2-ethylhexyl)phenyl]-3-ethylheptylidene]propanedioic acid |
| SMILES | CCCCC(CC)CC(=C(C(=O)O)C(=O)O)c1ccc(N)cc1CC(CC)CCCC |
| InChI | InChI=1S/C26H41NO4/c1-5-9-11-18(7-3)15-20-17-21(27)13-14-22(20)23(24(25(28)29)26(30)31)16-19(8-4)12-10-6-2/h13-14,17-19H,5-12,15-16,27H2,1-4H3,(H,28,29)(H,30,31) |
| InChIKey | AOHNRXMXQJUKGR-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|