About N-(2-chlorophenyl)-2-methyl-5-phenylaniline;2-methyl-5-phenylaniline
N-(2-chlorophenyl)-2-methyl-5-phenylaniline;2-methyl-5-phenylaniline (PubChem CID 158474341) has the molecular formula C32H29ClN2
and a molecular weight of 477.05 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-methyl-5-phenylaniline;2-methyl-5-phenylaniline.
Molecular Properties
| Compound Name | N-(2-chlorophenyl)-2-methyl-5-phenylaniline;2-methyl-5-phenylaniline |
| PubChem CID | 158474341 |
| Molecular Formula | C32H29ClN2 |
| Molecular Weight | 477.05 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | N-(2-chlorophenyl)-2-methyl-5-phenylaniline;2-methyl-5-phenylaniline |
| SMILES | Cc1ccc(-c2ccccc2)cc1N.Cc1ccc(-c2ccccc2)cc1Nc1ccccc1Cl |
| InChI | InChI=1S/C19H16ClN.C13H13N/c1-14-11-12-16(15-7-3-2-4-8-15)13-19(14)21-18-10-6-5-9-17(18)20;1-10-7-8-12(9-13(10)14)11-5-3-2-4-6-11/h2-13,21H,1H3;2-9H,14H2,1H3 |
| InChIKey | HGTARDRIJMVAIT-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.05 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chlorophenyl)-2-methyl-5-phenylaniline;2-methyl-5-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chlorophenyl)-2-methyl-5-phenylaniline;2-methyl-5-phenylaniline?
The IUPAC name of N-(2-chlorophenyl)-2-methyl-5-phenylaniline;2-methyl-5-phenylaniline (CID 158474341) is N-(2-chlorophenyl)-2-methyl-5-phenylaniline;2-methyl-5-phenylaniline.
What is the SMILES notation for N-(2-chlorophenyl)-2-methyl-5-phenylaniline;2-methyl-5-phenylaniline?
The canonical SMILES for N-(2-chlorophenyl)-2-methyl-5-phenylaniline;2-methyl-5-phenylaniline is Cc1ccc(-c2ccccc2)cc1N.Cc1ccc(-c2ccccc2)cc1Nc1ccccc1Cl.
What is the InChIKey of N-(2-chlorophenyl)-2-methyl-5-phenylaniline;2-methyl-5-phenylaniline?
The InChIKey is HGTARDRIJMVAIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16ClN.C13H13N/c1-14-11-12-16(15-7-3-2-4-8-15)13-19(14)21-18-10-6-5-9-17(18)20;1-10-7-8-12(9-13(10)14)11-5-3-2-4-6-11/h2-13,21H,1H3;2-9H,14H2,1H3.
What are the key properties of N-(2-chlorophenyl)-2-methyl-5-phenylaniline;2-methyl-5-phenylaniline?
N-(2-chlorophenyl)-2-methyl-5-phenylaniline;2-methyl-5-phenylaniline has a molecular weight of 477.05 g/mol, XLogP of 9.30, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chlorophenyl)-2-methyl-5-phenylaniline;2-methyl-5-phenylaniline is sourced from PubChem (CID 158474341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).