About ethane;1-N-methyl-2-N-(2-methyl-5-phenylphenyl)benzene-1,2-diamine
ethane;1-N-methyl-2-N-(2-methyl-5-phenylphenyl)benzene-1,2-diamine (PubChem CID 143291744) has the molecular formula C22H26N2
and a molecular weight of 318.46 g/mol. Its IUPAC name is ethane;1-N-methyl-2-N-(2-methyl-5-phenylphenyl)benzene-1,2-diamine.
Molecular Properties
| Compound Name | ethane;1-N-methyl-2-N-(2-methyl-5-phenylphenyl)benzene-1,2-diamine |
| PubChem CID | 143291744 |
| Molecular Formula | C22H26N2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | ethane;1-N-methyl-2-N-(2-methyl-5-phenylphenyl)benzene-1,2-diamine |
| SMILES | CC.CNc1ccccc1Nc1cc(-c2ccccc2)ccc1C |
| InChI | InChI=1S/C20H20N2.C2H6/c1-15-12-13-17(16-8-4-3-5-9-16)14-20(15)22-19-11-7-6-10-18(19)21-2;1-2/h3-14,21-22H,1-2H3;1-2H3 |
| InChIKey | IDFJHPQXFNIEOJ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-N-methyl-2-N-(2-methyl-5-phenylphenyl)benzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-N-methyl-2-N-(2-methyl-5-phenylphenyl)benzene-1,2-diamine?
The IUPAC name of ethane;1-N-methyl-2-N-(2-methyl-5-phenylphenyl)benzene-1,2-diamine (CID 143291744) is ethane;1-N-methyl-2-N-(2-methyl-5-phenylphenyl)benzene-1,2-diamine.
What is the SMILES notation for ethane;1-N-methyl-2-N-(2-methyl-5-phenylphenyl)benzene-1,2-diamine?
The canonical SMILES for ethane;1-N-methyl-2-N-(2-methyl-5-phenylphenyl)benzene-1,2-diamine is CC.CNc1ccccc1Nc1cc(-c2ccccc2)ccc1C.
What is the InChIKey of ethane;1-N-methyl-2-N-(2-methyl-5-phenylphenyl)benzene-1,2-diamine?
The InChIKey is IDFJHPQXFNIEOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2.C2H6/c1-15-12-13-17(16-8-4-3-5-9-16)14-20(15)22-19-11-7-6-10-18(19)21-2;1-2/h3-14,21-22H,1-2H3;1-2H3.
What are the key properties of ethane;1-N-methyl-2-N-(2-methyl-5-phenylphenyl)benzene-1,2-diamine?
ethane;1-N-methyl-2-N-(2-methyl-5-phenylphenyl)benzene-1,2-diamine has a molecular weight of 318.46 g/mol, XLogP of 6.47, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-N-methyl-2-N-(2-methyl-5-phenylphenyl)benzene-1,2-diamine is sourced from PubChem (CID 143291744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).