C16H20I2N2O4 — CID 158478897
molecular iodine;nitromethane;(4S)-2,5,6-trimethyl-4-phenyl-1,4-dihydropyridine-3-carboxylic acid (PubChem CID 158478897) has the molecular formula C16H20I2N2O4 and a molecular weight of 558.15 g/mol. Its IUPAC name is molecular iodine;nitromethane;(4S)-2,5,6-trimethyl-4-phenyl-1,4-dihydropyridine-3-carboxylic acid.
| Compound Name | molecular iodine;nitromethane;(4S)-2,5,6-trimethyl-4-phenyl-1,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 158478897 |
| Molecular Formula | C16H20I2N2O4 |
| Molecular Weight | 558.15 g/mol |
| Exact Mass | 557.95 |
| IUPAC Name | molecular iodine;nitromethane;(4S)-2,5,6-trimethyl-4-phenyl-1,4-dihydropyridine-3-carboxylic acid |
| SMILES | CC1=C(C)[C@H](c2ccccc2)C(C(=O)O)=C(C)N1.C[N+](=O)[O-].II |
| InChI | InChI=1S/C15H17NO2.CH3NO2.I2/c1-9-10(2)16-11(3)14(15(17)18)13(9)12-7-5-4-6-8-12;1-2(3)4;1-2/h4-8,13,16H,1-3H3,(H,17,18);1H3;/t13-;;/m1../s1 |
| InChIKey | HHGVHKDSVINUJI-FFXKMJQXSA-N |
| XLogP | 4.69 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.15 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|