About 1-(azidomethyl)-2,4-difluorobenzene;1-(chloromethyl)-2,4-difluorobenzene
1-(azidomethyl)-2,4-difluorobenzene;1-(chloromethyl)-2,4-difluorobenzene (PubChem CID 158479516) has the molecular formula C14H10ClF4N3
and a molecular weight of 331.70 g/mol. Its IUPAC name is 1-(azidomethyl)-2,4-difluorobenzene;1-(chloromethyl)-2,4-difluorobenzene.
Molecular Properties
| Compound Name | 1-(azidomethyl)-2,4-difluorobenzene;1-(chloromethyl)-2,4-difluorobenzene |
| PubChem CID | 158479516 |
| Molecular Formula | C14H10ClF4N3 |
| Molecular Weight | 331.70 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 1-(azidomethyl)-2,4-difluorobenzene;1-(chloromethyl)-2,4-difluorobenzene |
| SMILES | Fc1ccc(CCl)c(F)c1.[N-]=[N+]=NCc1ccc(F)cc1F |
| InChI | InChI=1S/C7H5ClF2.C7H5F2N3/c8-4-5-1-2-6(9)3-7(5)10;8-6-2-1-5(4-11-12-10)7(9)3-6/h1-3H,4H2;1-3H,4H2 |
| InChIKey | HHITVURWJSCCSV-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.70 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-(azidomethyl)-2,4-difluorobenzene;1-(chloromethyl)-2,4-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azidomethyl)-2,4-difluorobenzene;1-(chloromethyl)-2,4-difluorobenzene?
The IUPAC name of 1-(azidomethyl)-2,4-difluorobenzene;1-(chloromethyl)-2,4-difluorobenzene (CID 158479516) is 1-(azidomethyl)-2,4-difluorobenzene;1-(chloromethyl)-2,4-difluorobenzene.
What is the SMILES notation for 1-(azidomethyl)-2,4-difluorobenzene;1-(chloromethyl)-2,4-difluorobenzene?
The canonical SMILES for 1-(azidomethyl)-2,4-difluorobenzene;1-(chloromethyl)-2,4-difluorobenzene is Fc1ccc(CCl)c(F)c1.[N-]=[N+]=NCc1ccc(F)cc1F.
What is the InChIKey of 1-(azidomethyl)-2,4-difluorobenzene;1-(chloromethyl)-2,4-difluorobenzene?
The InChIKey is HHITVURWJSCCSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClF2.C7H5F2N3/c8-4-5-1-2-6(9)3-7(5)10;8-6-2-1-5(4-11-12-10)7(9)3-6/h1-3H,4H2;1-3H,4H2.
What are the key properties of 1-(azidomethyl)-2,4-difluorobenzene;1-(chloromethyl)-2,4-difluorobenzene?
1-(azidomethyl)-2,4-difluorobenzene;1-(chloromethyl)-2,4-difluorobenzene has a molecular weight of 331.70 g/mol, XLogP of 5.48, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azidomethyl)-2,4-difluorobenzene;1-(chloromethyl)-2,4-difluorobenzene is sourced from PubChem (CID 158479516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).