C8H7F2N3O — CID 80503360
2-azido-1-(2,5-difluorophenyl)ethanol (PubChem CID 80503360) has the molecular formula C8H7F2N3O and a molecular weight of 199.16 g/mol. Its IUPAC name is 2-azido-1-(2,5-difluorophenyl)ethanol.
| Compound Name | 2-azido-1-(2,5-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 80503360 |
| Molecular Formula | C8H7F2N3O |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 2-azido-1-(2,5-difluorophenyl)ethanol |
| SMILES | [N-]=[N+]=NCC(O)c1cc(F)ccc1F |
| InChI | InChI=1S/C8H7F2N3O/c9-5-1-2-7(10)6(3-5)8(14)4-12-13-11/h1-3,8,14H,4H2 |
| InChIKey | VAMWDFUZRXEQNU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|