C8H6Cl2FN3O — CID 165499072
(1R)-2-azido-1-(3,5-dichloro-2-fluorophenyl)ethanol (PubChem CID 165499072) has the molecular formula C8H6Cl2FN3O and a molecular weight of 250.06 g/mol. Its IUPAC name is (1R)-2-azido-1-(3,5-dichloro-2-fluorophenyl)ethanol.
| Compound Name | (1R)-2-azido-1-(3,5-dichloro-2-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 165499072 |
| Molecular Formula | C8H6Cl2FN3O |
| Molecular Weight | 250.06 g/mol |
| Exact Mass | 248.99 |
| IUPAC Name | (1R)-2-azido-1-(3,5-dichloro-2-fluorophenyl)ethanol |
| SMILES | [N-]=[N+]=NC[C@H](O)c1cc(Cl)cc(Cl)c1F |
| InChI | InChI=1S/C8H6Cl2FN3O/c9-4-1-5(7(15)3-13-14-12)8(11)6(10)2-4/h1-2,7,15H,3H2/t7-/m0/s1 |
| InChIKey | RWTWZYFORWOEBW-ZETCQYMHSA-N |
| XLogP | 3.48 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.06 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|