C39H48N3O12P — CID 158479978
[(2R,5R)-3-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy-methoxyphosphoryl]oxy-5-(2,4-dioxopyrimidin-1-yl)-4-(methylamino)oxolan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 158479978) has the molecular formula C39H48N3O12P and a molecular weight of 781.80 g/mol. Its IUPAC name is [(2R,5R)-3-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy-methoxyphosphoryl]oxy-5-(2,4-dioxopyrimidin-1-yl)-4-(methylamino)oxolan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,5R)-3-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy-methoxyphosphoryl]oxy-5-(2,4-dioxopyrimidin-1-yl)-4-(methylamino)oxolan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 158479978 |
| Molecular Formula | C39H48N3O12P |
| Molecular Weight | 781.80 g/mol |
| Exact Mass | 781.30 |
| IUPAC Name | [(2R,5R)-3-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy-methoxyphosphoryl]oxy-5-(2,4-dioxopyrimidin-1-yl)-4-(methylamino)oxolan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CNC1C(OP(=O)(OC)OCCOC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)[C@@H](COC(=O)C(C)(C)C)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C39H48N3O12P/c1-38(2,3)36(44)50-25-31-34(33(40-4)35(53-31)42-22-21-32(43)41-37(42)45)54-55(46,49-7)52-24-23-51-39(26-11-9-8-10-12-26,27-13-17-29(47-5)18-14-27)28-15-19-30(48-6)20-16-28/h8-22,31,33-35,40H,23-25H2,1-7H3,(H,41,43,45)/t31-,33?,34?,35-,55?/m1/s1 |
| InChIKey | GLZUVDHLKPGLMD-IMHDDDESSA-N |
| XLogP | 4.79 |
| TPSA | 174.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.80 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|