C28H26ClNO3S — CID 158481589
N-[4-[4-(2-chlorophenyl)-2-oxobutyl]phenyl]-2-phenylbenzenesulfinamide;hydrate (PubChem CID 158481589) has the molecular formula C28H26ClNO3S and a molecular weight of 492.04 g/mol. Its IUPAC name is N-[4-[4-(2-chlorophenyl)-2-oxobutyl]phenyl]-2-phenylbenzenesulfinamide;hydrate.
| Compound Name | N-[4-[4-(2-chlorophenyl)-2-oxobutyl]phenyl]-2-phenylbenzenesulfinamide;hydrate |
|---|---|
| PubChem CID | 158481589 |
| Molecular Formula | C28H26ClNO3S |
| Molecular Weight | 492.04 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | N-[4-[4-(2-chlorophenyl)-2-oxobutyl]phenyl]-2-phenylbenzenesulfinamide;hydrate |
| SMILES | O.O=C(CCc1ccccc1Cl)Cc1ccc(NS(=O)c2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24ClNO2S.H2O/c29-27-12-6-4-10-23(27)16-19-25(31)20-21-14-17-24(18-15-21)30-33(32)28-13-7-5-11-26(28)22-8-2-1-3-9-22;/h1-15,17-18,30H,16,19-20H2;1H2 |
| InChIKey | JYGNUOBPXONBTL-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.04 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |