C40H36BBrF2O6 — CID 158481703
1-bromo-3-(2,6-dimethoxyphenyl)-2-fluorobenzene;1,2,3,4,5-pentadeuterio-6-[3-(2,6-dimethoxyphenyl)-2-fluorophenyl]benzene;(2,3,4,5,6-pentadeuteriophenyl)boronic acid (PubChem CID 158481703) has the molecular formula C40H36BBrF2O6 and a molecular weight of 751.50 g/mol. Its IUPAC name is 1-bromo-3-(2,6-dimethoxyphenyl)-2-fluorobenzene;1,2,3,4,5-pentadeuterio-6-[3-(2,6-dimethoxyphenyl)-2-fluorophenyl]benzene;(2,3,4,5,6-pentadeuteriophenyl)boronic acid.
| Compound Name | 1-bromo-3-(2,6-dimethoxyphenyl)-2-fluorobenzene;1,2,3,4,5-pentadeuterio-6-[3-(2,6-dimethoxyphenyl)-2-fluorophenyl]benzene;(2,3,4,5,6-pentadeuteriophenyl)boronic acid |
|---|---|
| PubChem CID | 158481703 |
| Molecular Formula | C40H36BBrF2O6 |
| Molecular Weight | 751.50 g/mol |
| Exact Mass | 750.24 |
| IUPAC Name | 1-bromo-3-(2,6-dimethoxyphenyl)-2-fluorobenzene;1,2,3,4,5-pentadeuterio-6-[3-(2,6-dimethoxyphenyl)-2-fluorophenyl]benzene;(2,3,4,5,6-pentadeuteriophenyl)boronic acid |
| SMILES | COc1cccc(OC)c1-c1cccc(Br)c1F.[2H]c1c([2H])c([2H])c(-c2cccc(-c3c(OC)cccc3OC)c2F)c([2H])c1[2H].[2H]c1c([2H])c([2H])c(B(O)O)c([2H])c1[2H] |
| InChI | InChI=1S/C20H17FO2.C14H12BrFO2.C6H7BO2/c1-22-17-12-7-13-18(23-2)19(17)16-11-6-10-15(20(16)21)14-8-4-3-5-9-14;1-17-11-7-4-8-12(18-2)13(11)9-5-3-6-10(15)14(9)16;8-7(9)6-4-2-1-3-5-6/h3-13H,1-2H3;3-8H,1-2H3;1-5,8-9H/i3D,4D,5D,8D,9D;;1D,2D,3D,4D,5D |
| InChIKey | HHPCIZXSZPXFSA-DWPVVJBWSA-N |
| XLogP | 8.82 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.50 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|