C30H43N3O3 — CID 158485913
(3S)-3-[2-[(1R)-1-propan-2-yloxyethyl]phenyl]-3-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]prop-1-en-2-ol (PubChem CID 158485913) has the molecular formula C30H43N3O3 and a molecular weight of 493.69 g/mol. Its IUPAC name is (3S)-3-[2-[(1R)-1-propan-2-yloxyethyl]phenyl]-3-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]prop-1-en-2-ol.
| Compound Name | (3S)-3-[2-[(1R)-1-propan-2-yloxyethyl]phenyl]-3-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]prop-1-en-2-ol |
|---|---|
| PubChem CID | 158485913 |
| Molecular Formula | C30H43N3O3 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.33 |
| IUPAC Name | (3S)-3-[2-[(1R)-1-propan-2-yloxyethyl]phenyl]-3-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]prop-1-en-2-ol |
| SMILES | C=C(O)[C@H](c1ccccc1[C@@H](C)OC(C)C)N1CC[C@@H](OCCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C30H43N3O3/c1-21(2)36-23(4)27-12-5-6-13-28(27)29(22(3)34)33-18-16-26(20-33)35-19-8-7-11-25-15-14-24-10-9-17-31-30(24)32-25/h5-6,12-15,21,23,26,29,34H,3,7-11,16-20H2,1-2,4H3,(H,31,32)/t23-,26-,29-/m1/s1 |
| InChIKey | DSXIFTGBQIKVAD-YRKKDBSBSA-N |
| XLogP | 6.15 |
| TPSA | 66.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|