C21H17ClN2O — CID 158486582
2-[1-[(3-chlorophenyl)methyl]imidazol-4-yl]-1-(1H-inden-5-yl)ethanone (PubChem CID 158486582) has the molecular formula C21H17ClN2O and a molecular weight of 348.83 g/mol. Its IUPAC name is 2-[1-[(3-chlorophenyl)methyl]imidazol-4-yl]-1-(1H-inden-5-yl)ethanone.
| Compound Name | 2-[1-[(3-chlorophenyl)methyl]imidazol-4-yl]-1-(1H-inden-5-yl)ethanone |
|---|---|
| PubChem CID | 158486582 |
| Molecular Formula | C21H17ClN2O |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 2-[1-[(3-chlorophenyl)methyl]imidazol-4-yl]-1-(1H-inden-5-yl)ethanone |
| SMILES | O=C(Cc1cn(Cc2cccc(Cl)c2)cn1)c1ccc2c(c1)C=CC2 |
| InChI | InChI=1S/C21H17ClN2O/c22-19-6-1-3-15(9-19)12-24-13-20(23-14-24)11-21(25)18-8-7-16-4-2-5-17(16)10-18/h1-3,5-10,13-14H,4,11-12H2 |
| InChIKey | YWFBDNJNTJTMCD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |