C21H16ClN3O — CID 160953844
2-[1-[(3-chlorophenyl)methyl]imidazol-4-yl]-1-quinolin-3-ylethanone (PubChem CID 160953844) has the molecular formula C21H16ClN3O and a molecular weight of 361.83 g/mol. Its IUPAC name is 2-[1-[(3-chlorophenyl)methyl]imidazol-4-yl]-1-quinolin-3-ylethanone.
| Compound Name | 2-[1-[(3-chlorophenyl)methyl]imidazol-4-yl]-1-quinolin-3-ylethanone |
|---|---|
| PubChem CID | 160953844 |
| Molecular Formula | C21H16ClN3O |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 2-[1-[(3-chlorophenyl)methyl]imidazol-4-yl]-1-quinolin-3-ylethanone |
| SMILES | O=C(Cc1cn(Cc2cccc(Cl)c2)cn1)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C21H16ClN3O/c22-18-6-3-4-15(8-18)12-25-13-19(24-14-25)10-21(26)17-9-16-5-1-2-7-20(16)23-11-17/h1-9,11,13-14H,10,12H2 |
| InChIKey | SGYRTMCYBNPNOZ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |