C18H15ClN2O3 — CID 161085274
2-[1-[(3-chlorophenyl)methyl]imidazol-4-yl]-1-(3,4-dihydroxyphenyl)ethanone (PubChem CID 161085274) has the molecular formula C18H15ClN2O3 and a molecular weight of 342.78 g/mol. Its IUPAC name is 2-[1-[(3-chlorophenyl)methyl]imidazol-4-yl]-1-(3,4-dihydroxyphenyl)ethanone.
| Compound Name | 2-[1-[(3-chlorophenyl)methyl]imidazol-4-yl]-1-(3,4-dihydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 161085274 |
| Molecular Formula | C18H15ClN2O3 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-[1-[(3-chlorophenyl)methyl]imidazol-4-yl]-1-(3,4-dihydroxyphenyl)ethanone |
| SMILES | O=C(Cc1cn(Cc2cccc(Cl)c2)cn1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C18H15ClN2O3/c19-14-3-1-2-12(6-14)9-21-10-15(20-11-21)8-17(23)13-4-5-16(22)18(24)7-13/h1-7,10-11,22,24H,8-9H2 |
| InChIKey | TWLRBAAYBKIDHH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|