C36H30N8O7 — CID 158487848
5-[[4-[[4-[[4-[(3-carboxyphenyl)diazenyl]phenyl]methyl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]methyl]phenyl]diazenyl]benzene-1,3-dicarboxylic acid (PubChem CID 158487848) has the molecular formula C36H30N8O7 and a molecular weight of 686.69 g/mol. Its IUPAC name is 5-[[4-[[4-[[4-[(3-carboxyphenyl)diazenyl]phenyl]methyl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]methyl]phenyl]diazenyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[[4-[[4-[[4-[(3-carboxyphenyl)diazenyl]phenyl]methyl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]methyl]phenyl]diazenyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 158487848 |
| Molecular Formula | C36H30N8O7 |
| Molecular Weight | 686.69 g/mol |
| Exact Mass | 686.22 |
| IUPAC Name | 5-[[4-[[4-[[4-[(3-carboxyphenyl)diazenyl]phenyl]methyl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]methyl]phenyl]diazenyl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cccc(/N=N/c2ccc(Cc3nc(Cc4ccc(/N=N/c5cc(C(=O)O)cc(C(=O)O)c5)cc4)nc(N4CCOCC4)n3)cc2)c1 |
| InChI | InChI=1S/C36H30N8O7/c45-33(46)24-2-1-3-29(19-24)42-40-27-8-4-22(5-9-27)16-31-37-32(39-36(38-31)44-12-14-51-15-13-44)17-23-6-10-28(11-7-23)41-43-30-20-25(34(47)48)18-26(21-30)35(49)50/h1-11,18-21H,12-17H2,(H,45,46)(H,47,48)(H,49,50)/b42-40+,43-41+ |
| InChIKey | GXZMKGRKBAAWRV-IZRQRQPJSA-N |
| XLogP | 6.82 |
| TPSA | 212.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.69 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|