C15H13N3O4 — CID 21351282
5-[[4-(methylamino)phenyl]diazenyl]benzene-1,3-dicarboxylic acid (PubChem CID 21351282) has the molecular formula C15H13N3O4 and a molecular weight of 299.29 g/mol. Its IUPAC name is 5-[[4-(methylamino)phenyl]diazenyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[[4-(methylamino)phenyl]diazenyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 21351282 |
| Molecular Formula | C15H13N3O4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 5-[[4-(methylamino)phenyl]diazenyl]benzene-1,3-dicarboxylic acid |
| SMILES | CNc1ccc(/N=N/c2cc(C(=O)O)cc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C15H13N3O4/c1-16-11-2-4-12(5-3-11)17-18-13-7-9(14(19)20)6-10(8-13)15(21)22/h2-8,16H,1H3,(H,19,20)(H,21,22)/b18-17+ |
| InChIKey | JCRBWIAHIMNHBC-ISLYRVAYSA-N |
| XLogP | 3.54 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|