C22H26N2O4 — CID 102392240
5-[(3,5-ditert-butylphenyl)diazenyl]benzene-1,3-dicarboxylic acid (PubChem CID 102392240) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 5-[(3,5-ditert-butylphenyl)diazenyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[(3,5-ditert-butylphenyl)diazenyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 102392240 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 5-[(3,5-ditert-butylphenyl)diazenyl]benzene-1,3-dicarboxylic acid |
| SMILES | CC(C)(C)c1cc(/N=N/c2cc(C(=O)O)cc(C(=O)O)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H26N2O4/c1-21(2,3)15-10-16(22(4,5)6)12-18(11-15)24-23-17-8-13(19(25)26)7-14(9-17)20(27)28/h7-12H,1-6H3,(H,25,26)(H,27,28)/b24-23+ |
| InChIKey | OMRKIFXXTQRKFS-WCWDXBQESA-N |
| XLogP | 6.09 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|