C18H19N3O5 — CID 89354959
5-[[4-[1-(dimethylamino)ethoxy]phenyl]diazenyl]benzene-1,3-dicarboxylic acid (PubChem CID 89354959) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is 5-[[4-[1-(dimethylamino)ethoxy]phenyl]diazenyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[[4-[1-(dimethylamino)ethoxy]phenyl]diazenyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 89354959 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 5-[[4-[1-(dimethylamino)ethoxy]phenyl]diazenyl]benzene-1,3-dicarboxylic acid |
| SMILES | CC(Oc1ccc(/N=N/c2cc(C(=O)O)cc(C(=O)O)c2)cc1)N(C)C |
| InChI | InChI=1S/C18H19N3O5/c1-11(21(2)3)26-16-6-4-14(5-7-16)19-20-15-9-12(17(22)23)8-13(10-15)18(24)25/h4-11H,1-3H3,(H,22,23)(H,24,25)/b20-19+ |
| InChIKey | OLGJFIKUQKTPDM-FMQUCBEESA-N |
| XLogP | 3.78 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|